CAS 2345-51-9
:3-Butynoic acid
Description:
3-Butynoic acid, with the CAS number 2345-51-9, is an alkyne carboxylic acid characterized by the presence of a triple bond between the second and third carbon atoms in its carbon chain. This compound has a molecular formula of C4H6O2, indicating it contains four carbon atoms, six hydrogen atoms, and two oxygen atoms. It typically appears as a colorless to pale yellow liquid with a pungent odor. 3-Butynoic acid is known for its acidity, which is attributed to the carboxylic acid functional group (-COOH), allowing it to donate protons in solution. The presence of the triple bond contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of various chemical compounds. Additionally, it can undergo typical reactions associated with carboxylic acids, such as esterification and amidation. Due to its unique structure, 3-butynoic acid can also participate in addition reactions characteristic of alkynes. Safety precautions should be taken when handling this compound, as it may be irritating to the skin and respiratory system.
Formula:C4H4O2
InChI:InChI=1S/C4H4O2/c1-2-3-4(5)6/h1H,3H2,(H,5,6)
InChI key:InChIKey=KKAHGSQLSTUDAV-UHFFFAOYSA-N
SMILES:C(C(O)=O)C#C
Synonyms:- 2-Ethynylacetic acid
- But-3-Ynoic Acid
- 3-Butynoic acid
- 3-butynoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Butynoic Acid
CAS:Formula:C4H4O2Purity:>95.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:84.073-Butynoic Acid
CAS:3-Butynoic AcidFormula:C4H4O2Purity:98%Color and Shape:Solid-PowderMolecular weight:84.07Ref: IN-DA002NA2
50gTo inquire100gTo inquire100mg24.00€250mg25.00€1g52.00€5g127.00€10g163.00€25g358.00€250g2,395.00€500g4,101.00€1kg7,513.00€3-Butynoic acid
CAS:Formula:C4H4O2Purity:97%Color and Shape:Solid, White to yellowish powderMolecular weight:84.0743-Butynoic Acid
CAS:Controlled ProductApplications 3-BUTYNOIC ACID (cas# 2345-51-9) is a useful research chemical.
Formula:C4H4O2Color and Shape:NeatMolecular weight:84.073-Butynoic acid
CAS:3-Butynoic acid is an acyl coenzyme A dehydrogenase inhibitor that is a substrate for D-lactate dehydrogenase and can be used to study lactate metabolism.Formula:C4H4O2Purity:98%Color and Shape:SolidMolecular weight:84.07





