CymitQuimica logo

CAS 23464-98-4

:

3-(5-phenyl-1,3,4-oxadiazol-2-yl)propanoic acid

Description:
3-(5-Phenyl-1,3,4-oxadiazol-2-yl)propanoic acid is an organic compound characterized by its oxadiazole ring, which contributes to its unique chemical properties. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its reactivity and solubility. This compound features a propanoic acid functional group, which imparts acidic properties and allows for potential interactions with bases or nucleophiles. The oxadiazole moiety is known for its stability and can participate in various chemical reactions, making this compound of interest in medicinal chemistry and materials science. Its structure suggests potential applications in pharmaceuticals, particularly in the development of bioactive compounds. Additionally, the compound's molecular interactions may be influenced by hydrogen bonding due to the carboxylic acid group, which can affect its solubility in different solvents. Overall, 3-(5-phenyl-1,3,4-oxadiazol-2-yl)propanoic acid exhibits a combination of aromatic, acidic, and heterocyclic characteristics that make it a subject of interest in various chemical research fields.
Formula:C11H10N2O3
InChI:InChI=1/C11H10N2O3/c14-10(15)7-6-9-12-13-11(16-9)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,14,15)
InChI key:CUYMDSTYUZAYFH-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1nnc(CCC(=O)[O-])o1
Synonyms:
  • 1,3,4-oxadiazole-2-propanoic acid, 5-phenyl-
Found 4 products.