CymitQuimica logo

CAS 23499-01-6

:

4-Piperidinone, 1-(4-nitrophenyl)-

Description:
4-Piperidinone, 1-(4-nitrophenyl)-, also known by its CAS number 23499-01-6, is an organic compound characterized by the presence of a piperidinone ring and a nitrophenyl substituent. This compound features a six-membered saturated ring containing a nitrogen atom and a carbonyl group, which contributes to its ketone functionality. The nitrophenyl group, derived from a phenol with a nitro substituent at the para position, imparts distinct electronic properties and can influence the compound's reactivity and solubility. Typically, compounds of this nature are of interest in medicinal chemistry and materials science due to their potential biological activity and utility as intermediates in the synthesis of pharmaceuticals. The presence of both the piperidinone and nitrophenyl moieties suggests potential applications in drug development, particularly in the design of compounds targeting various biological pathways. As with many organic compounds, safety and handling precautions should be observed, given the potential toxicity associated with nitro groups.
Formula:C11H12N2O3
InChI:InChI=1S/C11H12N2O3/c14-11-5-7-12(8-6-11)9-1-3-10(4-2-9)13(15)16/h1-4H,5-8H2
InChI key:CRGRJUULGQHKOZ-UHFFFAOYSA-N
SMILES:C1CN(CCC1=O)C2=CC=C(C=C2)[N+](=O)[O-]
Found 5 products.