CymitQuimica logo

CAS 23602-61-1

:

Benzaldehyde, 3,4-dichloro-2-hydroxy-

Description:
Benzaldehyde, 3,4-dichloro-2-hydroxy- (CAS 23602-61-1) is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with a formyl group (–CHO), two chlorine atoms, and a hydroxyl group (–OH). This compound is a derivative of benzaldehyde, where the chlorine atoms are located at the 3 and 4 positions relative to the hydroxyl group at the 2 position. It typically appears as a colorless to pale yellow liquid with a distinct aromatic odor. The presence of the hydroxyl group imparts some polar characteristics, enhancing its solubility in polar solvents, while the chlorine substituents can influence its reactivity and stability. Benzaldehyde derivatives are often used in organic synthesis, as intermediates in the production of pharmaceuticals, and in the fragrance industry. Additionally, the compound may exhibit biological activity, making it of interest in various research fields, including medicinal chemistry and environmental studies. Safety precautions should be taken when handling this substance, as it may pose health risks upon exposure.
Formula:C7H4Cl2O2
InChI:InChI=1S/C7H4Cl2O2/c8-5-2-1-4(3-10)7(11)6(5)9/h1-3,11H
InChI key:WSUWZPYQCSWACI-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1C=O)O)Cl)Cl
Synonyms:
  • 3,4-Dichloro-2-hydroxybenzaldehyde
Found 3 products.