CAS 23616-57-1
:3-Iodo-7-azaindole
Description:
3-Iodo-7-azaindole is a heterocyclic compound that belongs to the class of indoles, specifically modified by the presence of an iodine atom and a nitrogen atom in its ring structure. The compound features a fused bicyclic system, where the nitrogen atom replaces a carbon atom in the indole framework, contributing to its unique chemical properties. It is characterized by its aromaticity, which is a result of the delocalized π-electrons in the ring structure. The presence of the iodine substituent enhances its reactivity, making it a useful intermediate in organic synthesis and medicinal chemistry. 3-Iodo-7-azaindole can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the electrophilic nature of the iodine atom. Additionally, its nitrogen atom can engage in hydrogen bonding, influencing its solubility and interaction with biological targets. This compound is of interest in the development of pharmaceuticals and agrochemicals, owing to its potential biological activity and structural versatility.
Formula:C7H5IN2
InChI:InChI=1/C7H5IN2/c8-6-4-10-7-5(6)2-1-3-9-7/h1-4H,(H,9,10)
SMILES:c1cc2c(c[nH]c2nc1)I
Synonyms:- 3-Iodo-1H-pyrrolo[2,3-b]pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Pyrrolo[2,3-b]pyridine, 3-iodo-
CAS:Formula:C7H5IN2Purity:95%Color and Shape:SolidMolecular weight:244.03253-Iodo-1H-pyrrolo[2,3-b]pyridine
CAS:Formula:C7H5IN2Purity:>95.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:244.043-Iodo-7-azaindole
CAS:3-Iodo-7-azaindoleFormula:C7H5IN2Purity:97%Color and Shape:SolidMolecular weight:244.032473-Iodo-1H-pyrrolo[2,3-b]pyridine
CAS:Formula:C7H5IN2Purity:98%Color and Shape:SolidMolecular weight:244.0353-Iodo-1H-pyrrolo[2,3-b]pyridine
CAS:3-Iodo-1H-pyrrolo[2,3-b]pyridine (3IOP) is a molecule that has been shown to be cytotoxic against human ovarian carcinoma cells. It induces significant cytotoxicity in cancer cell lines and inhibits the proliferation of lung fibroblasts. 3IOP has been shown to activate cellular signaling pathways and cause multinuclear DNA damage.
Formula:C7H5IN2Purity:Min. 95%Color and Shape:PowderMolecular weight:244.03 g/mol




