CAS 2362-50-7
:Thianthrene, 5-oxide
Description:
Thianthrene, 5-oxide, also known by its CAS number 2362-50-7, is a heterocyclic organic compound characterized by its unique structure that includes a thianthrene core with an oxide functional group. This compound typically exhibits a yellow to orange color and is known for its stability under standard conditions. Thianthrene, 5-oxide is soluble in organic solvents, which makes it useful in various chemical applications, including as a reagent in organic synthesis and as a potential photochemical agent. Its reactivity is influenced by the presence of the oxide group, which can participate in redox reactions. Additionally, thianthrene derivatives are of interest in materials science and organic electronics due to their electronic properties. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, thianthrene, 5-oxide is a compound of interest in both academic research and industrial applications.
Formula:C12H8OS2
InChI:InChI=1S/C12H8OS2/c13-15-11-7-3-1-5-9(11)14-10-6-2-4-8-12(10)15/h1-8H
InChI key:InChIKey=NYVGTLXTOJKHJN-UHFFFAOYSA-N
SMILES:O=S1C=2C(SC=3C1=CC=CC3)=CC=CC2
Synonyms:- Thianthrene, 5-oxide
- Thianthrene S-oxide
- Thianthrene monooxide
- Thianthrene 9-oxide
- Thianthrene oxide
- TCMDC-124300
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Thianthrene 5-Oxide
CAS:Formula:C12H8OS2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:232.32Thianthrene 5-oxide
CAS:Thianthrene 5-oxideFormula:C12H8OS2Purity:96%Color and Shape:SolidMolecular weight:232.32Ref: IN-DA002NX8
100mg24.00€250mg33.00€1g52.00€5g128.00€10g173.00€25g492.00€100g1,225.00€250g2,162.00€Thianthrene 5-oxide
CAS:Thianthrene 5-oxide is a molecule that has been synthesized by the reaction of hydrochloric acid and thioxanthone. The molecule contains five rings which are connected with intramolecular hydrogen bonds, forming a pseudoequatorial structure. Thianthrene 5-oxide contains two functional groups, the sulfinyl group and the hydroxyl group. These functional groups are nucleophilic and can react with electrophiles to form transfer reactions.Formula:C12H8OS2Purity:Min. 95%Color and Shape:PowderMolecular weight:232.3 g/mol





