CAS 23687-25-4
:4-Isoquinolinamine
Description:
4-Isoquinolinamine, with the CAS number 23687-25-4, is an organic compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. This compound features an amino group (-NH2) at the 4-position of the isoquinoline ring, contributing to its basicity and potential reactivity. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, reflecting its ability to engage in hydrogen bonding due to the presence of the amino group. 4-Isoquinolinamine is of interest in medicinal chemistry for its potential biological activities, including antimicrobial and anticancer properties. Its derivatives may exhibit varied pharmacological effects, making it a subject of research in drug development. Additionally, the compound can participate in various chemical reactions, such as acylation and alkylation, which can be utilized to synthesize more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H8N2
InChI:InChI=1S/C9H8N2/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-6H,10H2
InChI key:InChIKey=ISIUXVGHQFJYHM-UHFFFAOYSA-N
SMILES:NC=1C2=C(C=NC1)C=CC=C2
Synonyms:- 4-Aminoisoquinoline
- 4-Isoquinolinamine
- Isoquinolin-4-Amine
- Isoquinolin-4-ylamine
- Isoquinoline, 4-amino-
- NSC 170840
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Aminoisoquinoline
CAS:4-AminoisoquinolineFormula:C9H8N2Purity:≥95%Color and Shape:SolidMolecular weight:144.173224-Aminoisoquinoline
CAS:Formula:C9H8N2Purity:>98.0%(GC)(T)Color and Shape:White to Brown powder to crystalMolecular weight:144.184-Amino isoquinoline
CAS:4-Amino isoquinoline is a synthetic chemical that has a pyridine ring and chlorine atom. It can be synthesized by reacting 2,4-dichlorobenzene with acetaldehyde and hydrochloric acid. 4-Amino isoquinoline binds to the receptor that it interacts with, such as the ligand, dimethyl acetylenedicarboxylate, or taraxasterol acetate. This binding process can be used for treatment purposes. The ligand is usually introduced into the body through injection or ingestion of a drug. The ligand can also be attached to an antibody in order to target specific cells. The ligand has shown efficacy in treating cancerous tumors and other diseases like Parkinson's disease and Alzheimer's disease.
Formula:C9H8N2Purity:Min. 95%Color and Shape:White To Brown SolidMolecular weight:144.17 g/mol4-Aminoisoquinoline
CAS:Formula:C9H8N2Purity:97%Color and Shape:Solid, Crystalline PowderMolecular weight:144.177






