CAS 2369-13-3
:3-Fluoro-4-nitrobenzenamine
Description:
3-Fluoro-4-nitrobenzenamine, with the CAS number 2369-13-3, is an aromatic amine characterized by the presence of both a fluoro and a nitro group on a benzene ring. Specifically, the fluoro group is located at the meta position (3-position) and the nitro group at the para position (4-position) relative to the amine group. This compound typically appears as a solid and is known for its potential applications in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. The presence of the electronegative fluorine and nitro groups can significantly influence the compound's reactivity and solubility, making it a subject of interest in various chemical reactions. Additionally, due to the presence of the amine functional group, it can participate in nucleophilic substitution reactions and can be further modified to create more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks associated with aromatic amines.
Formula:C6H5FN2O2
InChI:InChI=1S/C6H5FN2O2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H,8H2
InChI key:InChIKey=KKQPNAPYVIIXFB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(F)C=C(N)C=C1
Synonyms:- 3-Fluoro-4-Nitro aniline
- 3-Fluoro-4-nitrobenzenamine
- 4-Nitro-3-fluoroaniline
- Aniline, 3-fluoro-4-nitro-
- Benzenamine, 3-fluoro-4-nitro-
- Fluoronitroaniline2
- NSC 402983
- 3-Fluoro-4-nitroaniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Fluoro-4-nitroaniline
CAS:Formula:C6H5FN2O2Purity:>95.0%(GC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:156.123-Fluoro-4-nitroaniline
CAS:3-Fluoro-4-nitroanilineFormula:C6H5FN2O2Purity:98%Color and Shape:Yellow SolidMolecular weight:156.1145Benzenamine, 3-fluoro-4-nitro-
CAS:Formula:C6H5FN2O2Purity:98%Color and Shape:SolidMolecular weight:156.1145Ref: IN-DA002O68
1kgTo inquire500gTo inquire1g28.00€5g31.00€10g53.00€25g80.00€50g122.00€100g173.00€250g568.00€3-Fluoro-4-nitroaniline
CAS:Formula:C6H5FN2O2Purity:95%Color and Shape:Solid, Brown powderMolecular weight:156.1163-Fluoro-4-nitroaniline
CAS:3-Fluoro-4-nitroaniline is an asymptomatic infection that inhibits the growth of bacteria by blocking the synthesis of proteins. This drug binds to the hydroxyl group, which is part of the amine function, and forms a covalent bond to the amino function in bacterial ribosomes. 3-Fluoro-4-nitroaniline blocks the formation of a tetrahydropyran ring in bacterial cells, preventing them from growing and multiplying. 3-Fluoro-4-nitroaniline also has been shown to have anticancer properties. It can inhibit tumor cell proliferation by inhibiting DNA synthesis and protein synthesis. The anticancer effects are due to its ability to inhibit cancer cell growth through inhibition of cellular enzymes such as topoisomerase II and cytosolic ribonucleotide reductase.Purity:Min. 95%




