
CAS 23691-27-2
:1,1,1,3-Tetrachloro-3-phenylpropane
Description:
1,1,1,3-Tetrachloro-3-phenylpropane, with the CAS number 23691-27-2, is an organic compound characterized by its chlorinated hydrocarbon structure. It features a central propane backbone substituted with four chlorine atoms and a phenyl group, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid with a relatively high density and low volatility. It is known for its stability under standard conditions, but it can undergo reactions such as nucleophilic substitution due to the presence of the chlorine atoms. The compound is primarily used in industrial applications, including as an intermediate in the synthesis of other chemicals. However, due to its chlorinated nature, it may pose environmental and health risks, necessitating careful handling and disposal. Its solubility in organic solvents and limited solubility in water further influence its behavior in various chemical processes. Overall, 1,1,1,3-Tetrachloro-3-phenylpropane exemplifies the characteristics typical of chlorinated organic compounds, including potential toxicity and environmental persistence.
Formula:C9H8Cl4
InChI:InChI=1S/C9H8Cl4/c10-8(6-9(11,12)13)7-4-2-1-3-5-7/h1-5,8H,6H2
InChI key:InChIKey=JJRCOEWDFJHOFK-UHFFFAOYSA-N
SMILES:C(CC(Cl)(Cl)Cl)(Cl)C1=CC=CC=C1
Synonyms:- (1,3,3,3-Tetrachloropropyl)benzene
- Benzene, (1,3,3,3-tetrachloropropyl)-
- 1-Phenyl-1,3,3,3-tetrachloropropane
- 1,1,1,3-Tetrachloro-3-phenylpropane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
