CAS 2374313-54-7: 2-Thiophenecarboxylic acid, 2-hexadecylhydrazide
Description:2-Thiophenecarboxylic acid, 2-hexadecylhydrazide is a chemical compound characterized by its unique structure, which includes a thiophene ring and a hydrazide functional group. The presence of the thiophene moiety imparts aromatic properties, while the carboxylic acid group contributes to its acidity and potential for hydrogen bonding. The hexadecyl chain enhances the hydrophobic characteristics of the molecule, making it more soluble in non-polar solvents. This compound may exhibit biological activity due to the hydrazide functionality, which is often associated with various pharmacological properties. Additionally, the length of the alkyl chain can influence its physical properties, such as melting point and boiling point, as well as its interactions with biological membranes. Overall, 2-Thiophenecarboxylic acid, 2-hexadecylhydrazide is of interest in fields such as medicinal chemistry and materials science, where its unique properties can be leveraged for various applications. Further studies would be necessary to fully elucidate its reactivity and potential uses.
Formula:C21H38N2OS
InChI:InChI=1S/C21H38N2OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-22-23-21(24)20-17-16-19-25-20/h16-17,19,22H,2-15,18H2,1H3,(H,23,24)
InChI key:InChIKey=HSHXDCVZWHOWCS-UHFFFAOYSA-N
SMILES:O=C(NNCCCCCCCCCCCCCCCC)C=1SC=CC1
- Synonyms:
- 2-Thiophenecarboxylic acid, 2-hexadecylhydrazide
- SIS 17

Ref: IN-DA01N19T
5mg | 88.00 € | ||
10mg | 141.00 € | ||
25mg | 196.00 € | ||
50mg | 181.00 € | ||
100mg | 304.00 € | ||
250mg | 507.00 € |

SIS17
Ref: TM-T5631
5mg | 65.00 € | ||
10mg | 97.00 € | ||
25mg | 180.00 € | ||
50mg | 305.00 € | ||
100mg | 487.00 € |

N'-Hexadecylthiophene-2-carbohydrazide
Ref: 10-F546392
250mg | To inquire |

SIS17
Ref: 3D-ZUD31354
25mg | 232.00 € | ||
50mg | 343.00 € | ||
100mg | 478.00 € |

SIS17 - Bio-X ™
Ref: 3D-BS300164
5mg | 145.00 € |