CymitQuimica logo

CAS 237432-11-0

:

Benzenamine, 3-fluoro-4-(4-thiomorpholinyl)-

Description:
Benzenamine, 3-fluoro-4-(4-thiomorpholinyl)-, also known by its CAS number 237432-11-0, is an organic compound characterized by its aromatic amine structure. This compound features a benzene ring substituted with a fluorine atom at the 3-position and a thiomorpholine group at the 4-position. The presence of the fluorine atom can influence the compound's reactivity and polarity, while the thiomorpholine moiety introduces a cyclic structure containing sulfur and nitrogen, which can enhance its biological activity and solubility in various solvents. Typically, compounds of this nature may exhibit properties such as moderate to high stability under standard conditions, potential for hydrogen bonding due to the amine group, and possible interactions with biological targets, making them of interest in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's molecular interactions and should be determined through experimental data or reliable databases.
Formula:C10H13FN2S
InChI:InChI=1S/C10H13FN2S/c11-9-7-8(12)1-2-10(9)13-3-5-14-6-4-13/h1-2,7H,3-6,12H2
InChI key:XWGJVQLPRBNUNS-UHFFFAOYSA-N
SMILES:C1CSCCN1C2=C(C=C(C=C2)N)F
Found 4 products.