CAS 23761-23-1
:3-Oxo-cyclobutanecarboxylic acid
Description:
3-Oxo-cyclobutanecarboxylic acid, with the CAS number 23761-23-1, is a cyclic compound characterized by a cyclobutane ring that features a ketone group (oxo) and a carboxylic acid functional group. This compound typically exhibits a molecular structure that includes four carbon atoms in the ring, with the ketone and carboxylic acid substituents contributing to its reactivity and potential applications in organic synthesis. The presence of both a carbonyl and a carboxylic acid group suggests that it can participate in various chemical reactions, such as nucleophilic additions and esterifications. Additionally, the cyclic nature of the compound may impart unique steric and electronic properties, influencing its behavior in chemical reactions. As a relatively specialized compound, it may be of interest in fields such as medicinal chemistry or materials science, where its derivatives could serve as intermediates or building blocks for more complex molecules. However, specific physical properties such as boiling point, melting point, and solubility would require empirical data for precise characterization.
Formula:C5H6O3
InChI:InChI=1/C5H6O3/c6-4-1-3(2-4)5(7)8/h3H,1-2H2,(H,7,8)
SMILES:C1C(CC1=O)C(=O)O
Synonyms:- 3-Oxocyclobutanecarboxylic Acid
- 3-Oxocyclobutane carboxylic acid
- (3-Oxocyclobutyl)carboxylic acid
- Cyclobutanecarboxylic Acid, 3-Oxo-
- 3-Oxo-Cyclobutanecarbuxylic Acid
- 3-Oxocyclobutane-1-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Oxocyclobutanecarboxylic Acid
CAS:Formula:C5H6O3Purity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:114.103-Oxocyclobutanecarboxylic acid, 98%
CAS:Useful intermediate for pharmaceutical, organic synthesis and organic light-emitting diode(OLED). This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar prFormula:C5H6O3Purity:98%Molecular weight:114.13-Oxo-Cyclobutanecarboxylicacid
CAS:Formula:C5H6O3Purity:97%Color and Shape:SolidMolecular weight:114.0993Ref: IN-DA0033RX
1g21.00€5g25.00€10g25.00€25g53.00€50g65.00€100g120.00€250g159.00€500g288.00€1kg534.00€5kg2,536.00€10kg4,837.00€25kg11,508.00€3-Oxocyclobutane-1-carboxylic acid
CAS:3-Oxocyclobutane-1-carboxylic acidFormula:C5H6O3Purity:97%Color and Shape:Cream to yellow SolidMolecular weight:114.099343-Oxocyclobutanecarboxylic acid
CAS:Formula:C5H6O3Purity:95.0%Color and Shape:Solid, Crystalline or PowderMolecular weight:114.1




