CymitQuimica logo

CAS 2379550-55-5

:

2-Methyl-1,2,3,4-tetrahydro-isoquinoline-6-boronic acid picol ester hydrochloride

Description:
2-Methyl-1,2,3,4-tetrahydro-isoquinoline-6-boronic acid picol ester hydrochloride is a chemical compound characterized by its complex structure, which includes a tetrahydroisoquinoline core, a boronic acid functional group, and a picolyl ester moiety. This compound is typically used in medicinal chemistry and pharmaceutical research due to its potential biological activity, particularly in the context of drug development. The presence of the boronic acid group suggests that it may participate in reversible covalent bonding with diols, making it useful in various biochemical applications, including enzyme inhibition and molecular recognition. The hydrochloride salt form enhances its solubility in aqueous solutions, which is advantageous for biological assays. Additionally, the methyl group at the 2-position of the isoquinoline ring may influence its pharmacokinetic properties, such as absorption and distribution. Overall, this compound exemplifies the intersection of organic synthesis and medicinal chemistry, with potential implications in therapeutic applications.
Formula:C16H25BClNO2
InChI:InChI=1S/C16H24BNO2.ClH/c1-15(2)16(3,4)20-17(19-15)14-7-6-13-11-18(5)9-8-12(13)10-14;/h6-7,10H,8-9,11H2,1-5H3;1H
InChI key:TVZNFYRGCINJGR-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(CN(CC3)C)C=C2.Cl
Synonyms:
  • 2-Methyl-1,2,3,4-tetrahydro-isoquinoline-6-boronic acid picol ester hydrochloride
Found 2 products.