CAS 2380-86-1
:6-Hydroxyindole
Description:
6-Hydroxyindole is an organic compound characterized by its indole structure, which features a fused benzene and pyrrole ring. The presence of a hydroxyl group at the 6-position of the indole ring imparts unique chemical properties, making it a versatile intermediate in organic synthesis. This compound is typically a white to light yellow solid and is soluble in polar solvents like water and alcohols. It exhibits properties such as being a weak acid due to the hydroxyl group, which can participate in hydrogen bonding. 6-Hydroxyindole is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in the synthesis of pharmaceuticals and dyes. Additionally, it can undergo various chemical reactions, such as oxidation and substitution, making it a valuable building block in the development of more complex molecules. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled.
Formula:C8H7NO
InChI:InChI=1S/C8H7NO/c10-7-2-1-6-3-4-9-8(6)5-7/h1-5,9-10H
InChI key:InChIKey=XAWPKHNOFIWWNZ-UHFFFAOYSA-N
SMILES:OC=1C=C2C(=CC1)C=CN2
Synonyms:- 1H-indol-6-ol
- 5,7-dichloro-1H-indole
- 6-Indolol
- Indol-6-ol
- 6-Hydroxyindole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
6-Hydroxyindole, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H7NOPurity:98%Molecular weight:133.156-Hydroxy-1H-indole
CAS:6-Hydroxy-1H-indoleFormula:C8H7NOPurity:97%Color and Shape:SolidMolecular weight:133.147286-Hydroxyindole
CAS:6-Hydroxyindole is a white to light brown crystalline or crystalline powder.Formula:C8H7NOPurity:99.14%Color and Shape:Solid PowderMolecular weight:133.156-Hydroxyindole
CAS:6-Hydroxyindole is a fine chemical that is used in the synthesis of many other compounds. It has been shown to be useful as a building block in organic chemistry, and can be used as a research chemical in the laboratory. 6-Hydroxyindole has also been found to be an excellent starting material for complex compounds, and is versatile enough to serve as a reaction component or intermediate. CAS No. 2380-86-1
Formula:C8H7NOPurity:Min. 99.0 Area-%Molecular weight:133.15 g/mol6-Hydroxyindole
CAS:Formula:C8H7NOPurity:98%Color and Shape:Solid, Off-white solidMolecular weight:133.15








