CymitQuimica logo

CAS 23808-46-0

:

5-(2-chloroethyl)-1,3-benzodioxole

Description:
5-(2-Chloroethyl)-1,3-benzodioxole is an organic compound characterized by its unique structure, which includes a benzodioxole moiety and a chloroethyl substituent. The presence of the chloroethyl group suggests that it may exhibit reactivity typical of alkyl halides, potentially participating in nucleophilic substitution reactions. The benzodioxole framework contributes to the compound's aromaticity and may influence its electronic properties, making it a candidate for various chemical applications, including medicinal chemistry and material science. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents, such as ethanol or dichloromethane, is expected, while its solubility in water may be limited due to the hydrophobic nature of the aromatic system. Safety data should be consulted, as the presence of chlorine can indicate potential toxicity or environmental hazards. Overall, 5-(2-chloroethyl)-1,3-benzodioxole is a compound of interest for further study in synthetic and applied chemistry.
Formula:C9H9ClO2
InChI:InChI=1/C9H9ClO2/c10-4-3-7-1-2-8-9(5-7)12-6-11-8/h1-2,5H,3-4,6H2
SMILES:c1cc2c(cc1CCCl)OCO2
Synonyms:
  • 5-(2-Chloroethyl)-1,3-benzodioxole
Found 1 products.