CymitQuimica logo

CAS 23815-87-4

:

bradykinin fragment 1-7

Description:
Bradykinin fragment 1-7, also known as BK 1-7, is a peptide derived from the degradation of bradykinin, a potent vasodilator involved in various physiological processes, including inflammation and pain modulation. This fragment consists of seven amino acids and retains some biological activity associated with its parent compound. It is known to interact with specific receptors, influencing cardiovascular functions and potentially exhibiting neuroprotective effects. The CAS number 23815-87-4 uniquely identifies this substance in chemical databases. Bradykinin fragment 1-7 is typically studied for its role in the renin-angiotensin system and its implications in various pathophysiological conditions, including hypertension and heart failure. Its stability and bioactivity make it a subject of interest in pharmacological research, particularly in the development of therapeutic agents targeting cardiovascular diseases. Additionally, its synthesis can be achieved through solid-phase peptide synthesis, allowing for the production of this fragment for research and potential clinical applications.
Formula:C35H52N10O9
InChI:InChI=1/C35H52N10O9/c36-22(10-4-14-39-35(37)38)31(50)44-16-6-12-26(44)33(52)43-15-5-11-25(43)30(49)40-19-28(47)41-23(18-21-8-2-1-3-9-21)29(48)42-24(20-46)32(51)45-17-7-13-27(45)34(53)54/h1-3,8-9,22-27,46H,4-7,10-20,36H2,(H,40,49)(H,41,47)(H,42,48)(H,53,54)(H4,37,38,39)/t22-,23-,24-,25-,26-,27-/m0/s1
InChI key:CRROPKNGCGVIOG-QCOJBMJGSA-N
SMILES:c1ccc(cc1)C[C@@H](C(=N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)O)O)N=C(CN=C([C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(=N)N)N)O)O
Synonyms:
  • H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Oh Acetate Salt
Found 6 products.