CAS 23815-91-0
:H-Arg-Pro-Pro-OH
Description:
H-Arg-Pro-Pro-OH, also known as a peptide with the sequence of arginine (Arg) and proline (Pro) residues, is a small molecule that exhibits characteristics typical of peptides. This compound is composed of three amino acids, with arginine contributing a positively charged side chain, which can influence its solubility and interaction with biological systems. The proline residues introduce rigidity into the peptide structure due to their unique cyclic structure, which can affect the conformation and stability of the molecule. H-Arg-Pro-Pro-OH is likely to be soluble in water due to the presence of the polar amino acids, making it suitable for various biochemical applications. Additionally, the presence of the hydroxyl group (OH) at the C-terminus suggests potential for further chemical modifications or interactions. This peptide may play a role in biological processes, such as signaling or as a building block for larger peptides and proteins. Its specific properties, including stability and reactivity, would depend on the surrounding conditions, such as pH and temperature.
Formula:C16H28N6O4
InChI:InChI=1/C16H28N6O4/c17-10(4-1-7-20-16(18)19)13(23)21-8-2-5-11(21)14(24)22-9-3-6-12(22)15(25)26/h10-12H,1-9,17H2,(H,25,26)(H4,18,19,20)/t10-,11-,12-/m0/s1
SMILES:C(C[C@@H](C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)O)N)CNC(=N)N
Synonyms:- Arginyl-prolyl-proline
- Arg-pro-pro
- L-Proline, 1-(1-L-arginyl-L-prolyl)-
- N~5~-(diaminomethylidene)-L-ornithyl-L-prolyl-L-proline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Bradykinin (1-3)
CAS:Bradykinin (1-3) is a fragment of Bradykinin. Bradykinin is an activates pain receptors.Formula:C16H28N6O4Purity:98%Color and Shape:SolidMolecular weight:368.43Bradykinin (1-3) sulfate salt
CAS:Bradykinin (BK) is a peptide hormone that is released by the endothelium of blood vessels in response to injury. Bradykinin (1-3) sulfate salt H-Arg-Pro-Pro-OH is a synthetic version of the BK sequence with sulfate groups on the amino acids and an additional acid substitution. This molecule has been shown to be fully functional as a copolymer in thrombin activation, oligopeptide, and angiotensin production. Bradykinin (1-3) sulfate salt H-Arg-Pro-Pro-OH is stable at pH 3 and above, which makes it suitable for use in nutrient media, such as media for growing bacteria or yeast. It also has been shown to have platelet aggregation properties similar to those found in natural BK.Formula:C16H28N6O4Purity:Min. 95%Molecular weight:368.43 g/mol

