CymitQuimica logo

CAS 23821-62-7

:

[2-phenyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]acetic acid

Description:
[2-phenyl-4-(thiophen-2-yl)-1,3-thiazol-5-yl]acetic acid, with the CAS number 23821-62-7, is a chemical compound characterized by its unique structural features, which include a thiazole ring, a phenyl group, and a thiophene moiety. This compound typically exhibits properties associated with both thiazole and thiophene derivatives, such as potential biological activity and the ability to participate in various chemical reactions. It may display moderate solubility in organic solvents and limited solubility in water, which is common for compounds containing aromatic and heterocyclic structures. The presence of the carboxylic acid functional group suggests it can act as an acid, potentially participating in acid-base reactions. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may serve as a building block for further chemical modifications or applications in drug development.
Formula:C15H11NO2S2
InChI:InChI=1/C15H11NO2S2/c17-13(18)9-12-14(11-7-4-8-19-11)16-15(20-12)10-5-2-1-3-6-10/h1-8H,9H2,(H,17,18)
SMILES:c1ccc(cc1)c1nc(c2cccs2)c(CC(=O)O)s1
Synonyms:
  • (2-Phenyl-4-thiophen-2-yl-thiazol-5-yl)-acetic acid
  • [2-Phenyl-4-(2-thienyl)-1,3-thiazol-5-yl]acetic acid
  • 5-Thiazoleacetic Acid, 2-Phenyl-4-(2-Thienyl)-
Found 1 products.