CymitQuimica logo

CAS 238418-75-2

:

Morpholine,4-(4-fluoro-2-nitrophenyl)-

Description:
Morpholine, 4-(4-fluoro-2-nitrophenyl)-, identified by CAS number 238418-75-2, is a chemical compound that features a morpholine ring substituted with a 4-fluoro-2-nitrophenyl group. Morpholine itself is a six-membered heterocyclic amine containing both nitrogen and oxygen atoms, which contributes to its basicity and solubility in polar solvents. The presence of the 4-fluoro-2-nitrophenyl substituent introduces both electron-withdrawing and electron-donating characteristics, influencing the compound's reactivity and potential applications. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, and the nitro group may enhance its pharmacological properties. Additionally, the fluorine atom can improve metabolic stability and lipophilicity. Overall, Morpholine, 4-(4-fluoro-2-nitrophenyl)- is a compound of interest for research in various fields, including organic synthesis and pharmaceutical applications.
Formula:C10H11FN2O3
InChI:InChI=1S/C10H11FN2O3/c11-8-1-2-9(10(7-8)13(14)15)12-3-5-16-6-4-12/h1-2,7H,3-6H2
InChI key:XEVFYVWDTJTEHQ-UHFFFAOYSA-N
SMILES:C1COCCN1C2=C(C=C(C=C2)F)[N+](=O)[O-]
Found 3 products.