CymitQuimica logo

CAS 23872-22-2

:

4,7-Dichloro-1,3-dihydro-2H-indol-2-one

Description:
4,7-Dichloro-1,3-dihydro-2H-indol-2-one, with the CAS number 23872-22-2, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features two chlorine substituents at the 4 and 7 positions of the indole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chlorine atoms can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, compounds of this type may possess biological activity, making them of interest in medicinal chemistry and drug development. The compound's stability, reactivity, and potential applications can vary based on the specific conditions and environments in which it is used. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or environmental impact.
Formula:C8H5Cl2NO
InChI:InChI=1S/C8H5Cl2NO/c9-5-1-2-6(10)8-4(5)3-7(12)11-8/h1-2H,3H2,(H,11,12)
InChI key:InChIKey=LVXWMUMMJRHVPF-UHFFFAOYSA-N
SMILES:ClC1=C2C(NC(=O)C2)=C(Cl)C=C1
Synonyms:
  • 4,7-Dichloro-1,3-dihydro-2H-indol-2-one
  • 2-Indolinone, 4,7-dichloro-
  • 2H-Indol-2-one, 4,7-dichloro-1,3-dihydro-
Found 2 products.