CAS 238750-77-1: Tosedostat
Description:Tosedostat, with the CAS number 238750-77-1, is a synthetic compound classified as a small molecule inhibitor. It primarily functions as an aminopeptidase N inhibitor, which interferes with the metabolism of amino acids and proteins. Tosedostat has been investigated for its potential therapeutic applications, particularly in the treatment of certain types of cancer, including hematological malignancies. The compound exhibits a mechanism of action that involves the inhibition of protein synthesis, leading to the induction of apoptosis in cancer cells. Tosedostat is typically administered in a clinical setting and has been evaluated in various clinical trials to assess its efficacy and safety profile. Its solubility and stability characteristics are important for formulation and delivery in therapeutic contexts. As with many investigational drugs, ongoing research aims to better understand its pharmacokinetics, optimal dosing regimens, and potential side effects. Overall, Tosedostat represents a promising avenue in cancer treatment, particularly for patients who may not respond to conventional therapies.
Formula:C21H30N2O6
InChI:InChI=1/C21H30N2O6/c1-13(2)12-16(18(24)20(26)23-28)19(25)22-17(14-8-4-3-5-9-14)21(27)29-15-10-6-7-11-15/h3-5,8-9,13,15-18,24,28H,6-7,10-12H2,1-2H3,(H,22,25)(H,23,26)/t16-,17+,18+/m1/s1
- Synonyms:
- alpha-[[(2R)-2-[(1S)-1-Hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]amino]benzeneacetic acid cyclopentyl ester