CymitQuimica logo

CAS 23876-39-3

:

1H-Indole, 4,7-dimethoxy-

Description:
1H-Indole, 4,7-dimethoxy- is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of two methoxy groups (-OCH3) at the 4 and 7 positions of the indole ring significantly influences its chemical properties and reactivity. This compound is typically a white to off-white solid and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water. It exhibits interesting biological activities, making it of interest in medicinal chemistry and pharmacology. The methoxy substituents can enhance the compound's lipophilicity and may affect its interaction with biological targets. Additionally, 1H-Indole, 4,7-dimethoxy- can undergo various chemical reactions, including electrophilic substitutions and oxidation, which are common for indole derivatives. Its unique structure and properties make it a valuable compound for research in various fields, including organic synthesis and drug development.
Formula:C10H11NO2
InChI:InChI=1S/C10H11NO2/c1-12-8-3-4-9(13-2)10-7(8)5-6-11-10/h3-6,11H,1-2H3
InChI key:OUDGAYDZZUTPPC-UHFFFAOYSA-N
SMILES:COC1=C2C=CNC2=C(C=C1)OC
Found 4 products.