CymitQuimica logo

CAS 239135-48-9

:

5-fluoro-2-(trifluoromethyl)benzyl bromide

Description:
5-Fluoro-2-(trifluoromethyl)benzyl bromide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a fluorine atom and a trifluoromethyl group. The presence of the bromine atom enhances its reactivity, making it useful in various chemical synthesis applications, particularly in the field of medicinal chemistry and agrochemicals. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its molecular structure contributes to its unique physical and chemical properties, such as a relatively high boiling point and moderate solubility in organic solvents. The trifluoromethyl group is known for imparting lipophilicity and influencing the compound's biological activity. Additionally, the compound's reactivity can be attributed to the presence of both the bromine and fluorine substituents, which can participate in nucleophilic substitution reactions. Safety precautions should be observed when handling this compound, as it may pose health risks due to its halogenated nature.
Formula:C8H5BrF4
InChI:InChI=1/C8H5BrF4/c9-4-5-3-6(10)1-2-7(5)8(11,12)13/h1-3H,4H2
InChI key:MQZWBTRGSDOAIO-UHFFFAOYSA-N
SMILES:c1cc(c(cc1F)CBr)C(F)(F)F
Synonyms:
  • 2-Trifluoromethyl-5-fluorobenzylbromide
  • 2-(Bromomethyl)-4-Fluoro-1-(Trifluoromethyl)Benzene
Found 2 products.