CymitQuimica logo

CAS 23927-13-1

:

Cyclo(-D-Ala-D-Ala)

Description:
Cyclo(-D-Ala-D-Ala) is a cyclic dipeptide composed of two D-alanine residues linked by a peptide bond in a cyclic structure. This compound is notable for its role in antibiotic resistance, particularly in relation to vancomycin, an antibiotic that targets bacterial cell wall synthesis. The cyclic nature of Cyclo(-D-Ala-D-Ala) contributes to its stability and resistance to enzymatic degradation, making it a significant molecule in the study of bacterial cell wall biosynthesis and antibiotic interactions. It is often used in research to understand the mechanisms of antibiotic resistance and to develop new therapeutic strategies. The compound is typically characterized by its molecular weight, solubility in various solvents, and its ability to form hydrogen bonds, which are crucial for its biological activity. Additionally, its stereochemistry, being composed of D-amino acids, distinguishes it from naturally occurring peptides, which are usually composed of L-amino acids. Overall, Cyclo(-D-Ala-D-Ala) serves as an important model for studying peptide interactions and antibiotic resistance mechanisms in bacteria.
Formula:C6H10N2O2
InChI:InChI=1S/C6H10N2O2/c1-3-5(9)8-4(2)6(10)7-3/h3-4H,1-2H3,(H,7,10)(H,8,9)/t3-,4-/m1/s1
InChI key:WWISPHBAYBECQZ-QWWZWVQMSA-N
SMILES:C[C@@H]1C(=O)N[C@@H](C(=O)N1)C
Found 2 products.