CymitQuimica logo

CAS 23928-51-0

:

6-Fluoro-1(2H)-phthalazinone

Description:
6-Fluoro-1(2H)-phthalazinone is a chemical compound characterized by its phthalazinone core structure, which features a fused bicyclic system containing both a benzene and a pyrazolone ring. The presence of a fluorine atom at the 6-position of the phthalazinone structure contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is of interest in medicinal chemistry and pharmaceutical research due to its potential applications in drug development, particularly in the context of targeting specific biological pathways. The compound's molecular structure allows for various functionalizations, which can enhance its pharmacological profile. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure. Overall, 6-Fluoro-1(2H)-phthalazinone represents a valuable compound in the field of organic synthesis and medicinal chemistry.
Formula:C8H5FN2O
InChI:InChI=1S/C8H5FN2O/c9-6-1-2-7-5(3-6)4-10-11-8(7)12/h1-4H,(H,11,12)
InChI key:InChIKey=OHOASKMOTVHBHO-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(F)=CC2)C=NN1
Synonyms:
  • 6-Fluoro-1(2H)-phthalazinone
  • 1-Phthalazinol, 6-fluoro-
  • 1(2H)-Phthalazinone, 6-fluoro-
Found 5 products.