CymitQuimica logo

CAS 23928-52-1

:

7-Fluoro-1(2H)-phthalazinone

Description:
7-Fluoro-1(2H)-phthalazinone is a chemical compound characterized by its unique structure, which includes a phthalazinone core with a fluorine substituent at the 7-position. This compound typically exhibits a solid state at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the fluorine atom can enhance the lipophilicity and metabolic stability of the molecule, making it an interesting candidate for drug design. Its molecular structure contributes to its reactivity and interaction with biological targets, which may include enzymes or receptors. Additionally, 7-Fluoro-1(2H)-phthalazinone may exhibit specific spectral properties, such as UV-Vis and NMR characteristics, that can be utilized for analytical purposes. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a valuable entity in the field of organic chemistry and pharmacology.
Formula:C8H5FN2O
InChI:InChI=1S/C8H5FN2O/c9-6-2-1-5-4-10-11-8(12)7(5)3-6/h1-4H,(H,11,12)
InChI key:InChIKey=QDIFSAJTLJORDC-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(F)C2)C=NN1
Synonyms:
  • 7-Fluoro-1(2H)-phthalazinone
  • 1-Phthalazinol, 7-fluoro-
  • 1(2H)-Phthalazinone, 7-fluoro-
Found 3 products.