CymitQuimica logo

CAS 239463-72-0

:

5-[(2R)-2-aminopropyl]-1-[3-(benzoyloxy)propyl]-2,3-dihydro-7-carbonitrile -1H-indole

Description:
The chemical substance known as 5-[(2R)-2-aminopropyl]-1-[3-(benzoyloxy)propyl]-2,3-dihydro-7-carbonitrile-1H-indole, with CAS number 239463-72-0, is a synthetic compound that belongs to the indole class of compounds. It features a complex structure characterized by an indole ring, which is a bicyclic structure consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. The presence of a carbonitrile group indicates potential reactivity and the ability to participate in various chemical reactions. The compound also contains an amino group, which can influence its biological activity and solubility. The benzoyloxy group suggests that it may have applications in medicinal chemistry, potentially acting as a pharmacophore in drug development. Overall, this compound's unique structural features may contribute to its potential biological activities, making it of interest in research related to pharmaceuticals and organic synthesis. However, specific biological properties and applications would require further investigation and characterization.
Formula:C22H25N3O2
InChI:InChI=1S/C22H25N3O2/c1-16(24)12-17-13-19-8-10-25(21(19)20(14-17)15-23)9-5-11-27-22(26)18-6-3-2-4-7-18/h2-4,6-7,13-14,16H,5,8-12,24H2,1H3/t16-/m1/s1
InChI key:SPIYQPPDQNLNDT-MRXNPFEDSA-N
SMILES:C[C@H](CC1=CC2=C(C(=C1)C#N)N(CC2)CCCOC(=O)C3=CC=CC=C3)N
Found 2 products.