CymitQuimica logo

CAS 239463-89-9

:

4-chloro-6,8-difluoroquinoline

Description:
4-Chloro-6,8-difluoroquinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of chlorine and fluorine substituents at specific positions (4, 6, and 8) on the quinoline structure significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a pale yellow solid at room temperature and is sparingly soluble in water but more soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). Its unique halogen substitutions can enhance its biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various biological activities, including antimicrobial or antitumor properties, although specific biological data would depend on empirical studies. As with many halogenated compounds, it is essential to handle 4-chloro-6,8-difluoroquinoline with care due to potential toxicity and environmental concerns associated with halogenated organic compounds.
Formula:C9H4ClF2N
InChI:InChI=1/C9H4ClF2N/c10-7-1-2-13-9-6(7)3-5(11)4-8(9)12/h1-4H
InChI key:NBYDBLFWTPXYFH-UHFFFAOYSA-N
SMILES:c1cnc2c(cc(cc2F)F)c1Cl
Synonyms:
  • Quinoline, 4-Chloro-6,8-Difluoro-
Found 4 products.