CymitQuimica logo

CAS 23967-51-3

:

1,4-dimethyl-1H-indole-2-carboxylic acid

Description:
1,4-Dimethyl-1H-indole-2-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of two methyl groups at the 1 and 4 positions of the indole ring contributes to its unique chemical properties, while the carboxylic acid functional group at the 2 position enhances its acidity and reactivity. This compound is typically a solid at room temperature and is soluble in polar solvents due to the carboxylic acid group. It may exhibit biological activity, making it of interest in pharmaceutical research. The compound's structure allows for potential interactions with various biological targets, and it may participate in reactions typical of carboxylic acids, such as esterification or amidation. Additionally, its indole framework is known for its presence in many natural products and pharmaceuticals, suggesting potential applications in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C11H11NO2
InChI:InChI=1/C11H11NO2/c1-7-4-3-5-9-8(7)6-10(11(13)14)12(9)2/h3-6H,1-2H3,(H,13,14)
InChI key:IHZAGSISYYKXQJ-UHFFFAOYSA-N
SMILES:Cc1cccc2c1cc(C(=O)O)n2C
Synonyms:
  • 1H-indole-2-carboxylic acid, 1,4-dimethyl-
Found 4 products.