CymitQuimica logo

CAS 23984-82-9

:

Benzoic acid, 2-methyl-4-(trifluoromethyl)-

Description:
Benzoic acid, 2-methyl-4-(trifluoromethyl)-, also known by its CAS number 23984-82-9, is an aromatic carboxylic acid characterized by the presence of a benzoic acid core with a methyl group and a trifluoromethyl group attached to the aromatic ring. This compound typically exhibits a white crystalline solid form and is known for its relatively low solubility in water, while being more soluble in organic solvents. The trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. Benzoic acid derivatives often display antimicrobial properties, making them of interest in various applications, including pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group can also enhance the compound's stability and reactivity in certain chemical reactions. Overall, this compound is significant in both industrial and research contexts due to its distinctive structural features and functional properties.
Formula:C9H7F3O2
InChI:InChI=1S/C9H7F3O2/c1-5-4-6(9(10,11)12)2-3-7(5)8(13)14/h2-4H,1H3,(H,13,14)
InChI key:VGRSPVWAKZZUFU-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)C(F)(F)F)C(=O)O
Found 5 products.