CymitQuimica logo

CAS 2402-78-0

:

2,6-Dichloropyridine

Description:
2,6-Dichloropyridine is a heterocyclic aromatic compound characterized by a pyridine ring substituted with two chlorine atoms at the 2 and 6 positions. Its molecular formula is C5H3Cl2N, and it has a molecular weight that reflects the presence of these halogen substituents. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature, and it has a distinctive odor. 2,6-Dichloropyridine is known for its role as an intermediate in the synthesis of various agrochemicals and pharmaceuticals. It exhibits moderate solubility in water and is more soluble in organic solvents, making it useful in various chemical reactions. The presence of chlorine atoms enhances its reactivity, allowing it to participate in nucleophilic substitution reactions. Additionally, it is important to handle this compound with care due to its potential toxicity and environmental impact. Proper safety measures should be taken when working with 2,6-Dichloropyridine in laboratory or industrial settings.
Formula:C5H3Cl2N
InChI:InChI=1S/C5H3Cl2N/c6-4-2-1-3-5(7)8-4/h1-3H
InChI key:InChIKey=FILKGCRCWDMBKA-UHFFFAOYSA-N
SMILES:ClC=1N=C(Cl)C=CC1
Synonyms:
  • 2,6-Dichloro Pyridine
  • NSC 76606
  • Pyridine, 2,6-dichloro-
  • 2,6-Dichloropyridine
Found 10 products.