CymitQuimica logo

CAS 2402-82-6

:

3,3-Bis(iodomethyl)oxetane

Description:
3,3-Bis(iodomethyl)oxetane is a chemical compound characterized by its unique oxetane ring structure, which is a four-membered cyclic ether. The presence of two iodomethyl groups at the 3-position of the oxetane ring significantly influences its reactivity and properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis, particularly in the preparation of more complex molecules due to its ability to undergo various chemical transformations. The iodomethyl groups can serve as leaving groups in nucleophilic substitution reactions, making the compound a useful intermediate in the synthesis of iodinated compounds. Additionally, 3,3-Bis(iodomethyl)oxetane may exhibit moderate to high toxicity, necessitating careful handling and storage. Its stability can be affected by light and moisture, so it is often stored in dark, dry conditions. Overall, this compound is of interest in both academic and industrial chemistry for its versatile reactivity and potential applications in material science and pharmaceuticals.
Formula:C5H8I2O
InChI:InChI=1/C5H8I2O/c6-1-5(2-7)3-8-4-5/h1-4H2
InChI key:InChIKey=JRMFTYIUHNPQQY-UHFFFAOYSA-N
SMILES:C(I)C1(CI)COC1
Synonyms:
  • 3,3-Bis(iodomethyl)oxacyclobutane
  • NSC 281645
  • Oxetane, 3,3-Bis(Iodomethyl)-
  • 3,3-Bis(iodomethyl)oxetane
Found 3 products.