CymitQuimica logo

CAS 24036-63-3

:

1-phenyl-1H-1,2,4-triazole-3-carboxylic acid

Description:
1-Phenyl-1H-1,2,4-triazole-3-carboxylic acid is a heterocyclic organic compound characterized by its triazole ring, which is a five-membered ring containing three nitrogen atoms. This compound features a phenyl group attached to the triazole, contributing to its aromatic properties. The carboxylic acid functional group (-COOH) at the 3-position of the triazole ring imparts acidic characteristics, making it capable of participating in various chemical reactions, such as esterification and amidation. The presence of both the phenyl and carboxylic acid groups enhances its potential for hydrogen bonding and increases its solubility in polar solvents. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities, such as antifungal and herbicidal properties. Its molecular structure allows for diverse interactions, making it a valuable compound in synthetic chemistry and material science. Overall, 1-phenyl-1H-1,2,4-triazole-3-carboxylic acid is a versatile compound with significant implications in research and application.
Formula:C9H7N3O2
InChI:InChI=1/C9H7N3O2/c13-9(14)8-10-6-12(11-8)7-4-2-1-3-5-7/h1-6H,(H,13,14)
InChI key:ACFQGTMTFLDFLP-UHFFFAOYSA-N
SMILES:c1ccc(cc1)n1cnc(C(=O)O)n1
Synonyms:
  • 1H-1,2,4-triazole-3-carboxylic acid, 1-phenyl-
  • 1-Phenyl-1H-1,2,4-triazole-3-carboxylic acid
Found 4 products.