CymitQuimica logo

CAS 24047-72-1

:

(1R,2R,5R)-(+)-2-hydroxy-3-pinanone

Description:
(1R,2R,5R)-(+)-2-hydroxy-3-pinanone, with the CAS number 24047-72-1, is a chiral organic compound belonging to the class of ketones. It features a bicyclic structure derived from pinane, characterized by a hydroxyl group (-OH) and a carbonyl group (C=O) within its molecular framework. This compound is typically colorless to pale yellow and has a pleasant, pine-like aroma, making it of interest in the fragrance and flavor industries. Its stereochemistry, indicated by the (1R,2R,5R) configuration, contributes to its unique properties and potential applications in synthesizing other chiral molecules. The presence of the hydroxyl group also suggests that it can participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, (1R,2R,5R)-(+)-2-hydroxy-3-pinanone may exhibit biological activity, which warrants further investigation for potential uses in pharmaceuticals or agrochemicals. Overall, its distinct structural features and properties make it a valuable compound in various chemical applications.
Formula:C10H16O2
InChI:InChI=1/C10H16O2/c1-9(2)6-4-7(9)10(3,12)8(11)5-6/h6-7,12H,4-5H2,1-3H3/t6-,7-,10-/m1/s1
InChI key:VZRRCQOUNSHSGB-BRDIYROLSA-N
SMILES:CC1(C)[C@@H]2C[C@H]1[C@](C)(C(=O)C2)O
Synonyms:
  • (1R,2R,5R)-2-Hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one
  • bicyclo[3.1.1]heptan-3-one, 2-hydroxy-2,6,6-trimethyl-, (1R,2R,5R)-
Found 7 products.