CymitQuimica logo

CAS 24068-54-0

:

1-(5-methylisoxazol-3-yl)ethanone

Description:
1-(5-Methylisoxazol-3-yl)ethanone, with the CAS number 24068-54-0, is an organic compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features a methyl group at the 5-position of the isoxazole ring and an ethanone functional group, indicating the presence of a carbonyl group (C=O) adjacent to an ethyl group. The presence of the isoxazole moiety often imparts unique chemical reactivity and biological activity, making such compounds of interest in medicinal chemistry and drug development. Typically, compounds like this may exhibit properties such as moderate polarity due to the electronegative atoms in the ring, and they may participate in various chemical reactions, including nucleophilic attacks and electrophilic substitutions. The compound's solubility, stability, and reactivity can be influenced by the substituents on the isoxazole ring and the carbonyl group, which can affect its potential applications in pharmaceuticals or agrochemicals.
Formula:C6H7NO2
InChI:InChI=1/C6H7NO2/c1-4-3-6(5(2)8)7-9-4/h3H,1-2H3
InChI key:KYVXYWKQFCSMHL-UHFFFAOYSA-N
SMILES:Cc1cc(C(=O)C)no1
Found 4 products.