CymitQuimica logo

CAS 24078-25-9

:

methyl 4-(hydroxymethyl)-3-methylbenzoate

Description:
Methyl 4-(hydroxymethyl)-3-methylbenzoate, identified by its CAS number 24078-25-9, is an organic compound belonging to the class of benzoates. It features a benzoic acid structure with a methyl ester functional group and additional hydroxymethyl and methyl substituents on the aromatic ring. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many benzoate esters. Its molecular structure contributes to its potential applications in various fields, including pharmaceuticals and as a chemical intermediate in organic synthesis. The presence of hydroxymethyl and methyl groups can influence its reactivity and interaction with other chemical species. Additionally, it may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, methyl 4-(hydroxymethyl)-3-methylbenzoate is a versatile compound with unique properties stemming from its structural features.
Formula:C10H12O3
InChI:InChI=1S/C10H12O3/c1-7-5-8(10(12)13-2)3-4-9(7)6-11/h3-5,11H,6H2,1-2H3
InChI key:GPGKTIZFVDEARF-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)C(=O)OC)CO
Synonyms:
  • Benzoic acid, 4-(hydroxymethyl)-3-methyl-, methyl ester
  • methyl 4-(hydroxymethyl)-3-methylbenzoate
Found 3 products.