CAS 2409-36-1
:9H-Carbazole-9-methanol
Description:
9H-Carbazole-9-methanol, with the CAS number 2409-36-1, is an organic compound characterized by its structure, which features a carbazole moiety with a hydroxymethyl group attached at the 9-position. This compound typically appears as a white to off-white solid and is known for its aromatic properties due to the presence of the carbazole ring, which contributes to its stability and potential applications in organic electronics and photonics. The hydroxymethyl group enhances its solubility in polar solvents and may influence its reactivity, making it a useful intermediate in organic synthesis. Additionally, 9H-Carbazole-9-methanol can exhibit interesting photophysical properties, which may be leveraged in the development of fluorescent materials or as a building block in the synthesis of more complex organic compounds. Its chemical behavior can be influenced by factors such as pH and the presence of other functional groups, making it a versatile compound in various chemical applications.
Formula:C13H11NO
InChI:InChI=1S/C13H11NO/c15-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,15H,9H2
InChI key:InChIKey=LRQYFGXOJXXKGQ-UHFFFAOYSA-N
SMILES:C(O)N1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- 9-Hydroxymethylcarbazole
- 9H-carbazol-9-ylmethanol
- Ai3-61606
- Carbazole-9-methanol
- N-(Hydroxymethyl)carbazole
- Nsc 108694
- 9H-Carbazole-9-methanol
- 9H-Carbazole-9-methanol
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
