CAS 2409-61-2
:Bis(4-methylphenyl)phosphine oxide
Description:
Bis(4-methylphenyl)phosphine oxide, with the CAS number 2409-61-2, is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to two 4-methylphenyl groups and an oxygen atom. This compound typically appears as a colorless to pale yellow solid and is known for its stability and solubility in organic solvents. It exhibits properties such as being a good ligand in coordination chemistry and is often utilized in various applications, including organic synthesis and as a reagent in chemical reactions. The presence of the phosphine oxide functional group imparts unique reactivity, allowing it to participate in oxidation and coordination processes. Additionally, its structure contributes to its potential use in materials science, particularly in the development of polymers and other advanced materials. Safety data indicates that, like many organophosphorus compounds, it should be handled with care to avoid exposure, as it may pose health risks if ingested or inhaled.
Formula:C14H15OP
InChI:InChI=1S/C14H15OP/c1-11-3-7-13(8-4-11)16(15)14-9-5-12(2)6-10-14/h3-10,16H,1-2H3
InChI key:InChIKey=GCUWBTGMXUIKOB-UHFFFAOYSA-N
SMILES:P(=O)(C1=CC=C(C)C=C1)C2=CC=C(C)C=C2
Synonyms:- 1-Methyl-4-[(4-methylphenyl)-oxidophosphaniumyl]benzene
- Bis(4-Methylphenyl)Phosphane Oxide
- Bis(4-methylphenyl)phosphine oxide
- Bis(4-tolyl)phosphine oxide
- Bis-p-tolylphosphine oxide
- Di(4-methylphenyl)phosphinous acid
- Di(para-tolyl)phosphine oxide
- Di-p-tolylphosphine oxide
- Phosphine oxide, bis(4-methylphenyl)-
- Phosphine oxide, di-p-tolyl-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Di(p-tolyl)phosphine Oxide
CAS:Formula:C14H15OPPurity:>95.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:230.25Di-p-tolylphosphine oxide
CAS:Formula:C14H15OPPurity:95%Color and Shape:SolidMolecular weight:230.247Bis(p-tolyl)phosphine oxide, 98%
CAS:Bis(p-tolyl)phosphine oxide is used as an organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item coFormula:C14H14OPPurity:98%Molecular weight:229.24Di-p-tolylphosphine oxide
CAS:Di-p-tolylphosphine oxideFormula:C14H15OPPurity:98%Molecular weight:230.25Di-p-tolylphosphine oxide
CAS:Formula:C14H15OPPurity:95%Color and Shape:SolidMolecular weight:230.2421Di-p-tolylphosphine oxide
CAS:Di-p-tolylphosphine oxideFormula:C14H15OPPurity:98%Molecular weight:230.24





