CymitQuimica logo

CAS 24091-92-7

:

2'-Bromo-4-chlorophenylacetic acid methyl ester

Description:
2'-Bromo-4-chlorophenylacetic acid methyl ester is an organic compound characterized by its aromatic structure and the presence of both bromine and chlorine substituents on the phenyl ring. This compound features a methyl ester functional group, which contributes to its solubility in organic solvents. The presence of the bromine and chlorine atoms typically influences its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's molecular structure suggests it may exhibit biological activity, which is often explored in pharmaceutical research. Additionally, its unique combination of halogen substituents can affect its physical properties, such as melting point and boiling point, as well as its stability under different conditions. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental concerns. Overall, 2'-Bromo-4-chlorophenylacetic acid methyl ester is a compound of interest in both synthetic organic chemistry and medicinal chemistry.
Formula:C9H8BrClO2
InChI:InChI=1S/C9H8BrClO2/c1-13-9(12)8(10)6-2-4-7(11)5-3-6/h2-5,8H,1H3
InChI key:LWQLLIVTGSMSCT-UHFFFAOYSA-N
SMILES:COC(=O)C(C1=CC=C(C=C1)Cl)Br
Found 5 products.