CymitQuimica logo

CAS 24100-18-3

:

2-Bromo-3-methoxypyridine

Description:
2-Bromo-3-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the second position and a methoxy group (-OCH3) at the third position of the pyridine ring defines its structure and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and dichloromethane but has limited solubility in water due to the hydrophobic nature of the aromatic ring. 2-Bromo-3-methoxypyridine is often used as an intermediate in the synthesis of pharmaceuticals and agrochemicals, owing to its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the bromine atom can serve as a leaving group, facilitating further functionalization of the molecule. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C6H6BrNO
InChI:InChI=1S/C6H6BrNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3
InChI key:InChIKey=PDOWLYNSFYZIQX-UHFFFAOYSA-N
SMILES:O(C)C1=C(Br)N=CC=C1
Synonyms:
  • 2-Bromo-3-Methoxy Pyridine
  • Pyridine, 2-bromo-3-methoxy-
  • 2-Bromo-3-methoxypyridine
Found 5 products.