CAS 2410517-32-5
:TLR7 agonist 17
Description:
TLR7 agonist 17, identified by its CAS number 2410517-32-5, is a synthetic compound that acts as an agonist for Toll-like receptor 7 (TLR7). TLR7 is a pattern recognition receptor that plays a crucial role in the immune system by recognizing single-stranded RNA, which is often associated with viral infections. The activation of TLR7 by agonists like TLR7 agonist 17 can enhance the immune response, making it a potential candidate for therapeutic applications in infectious diseases and cancer immunotherapy. This compound is characterized by its ability to stimulate the production of pro-inflammatory cytokines and type I interferons, which are vital for antiviral defense. Additionally, TLR7 agonists are being explored for their potential in vaccine adjuvants, as they can boost the efficacy of vaccines by promoting a robust immune response. The specific chemical structure and properties of TLR7 agonist 17 contribute to its biological activity, making it a subject of interest in pharmaceutical research and development.
Formula:C25H37N7O3
InChI:InChI=1S/C25H37N7O3/c1-3-4-20(7-10-33)29-24-23-21(30-25(26)31-24)15-28-32(23)16-18-6-5-17(13-22(18)34-2)14-27-19-8-11-35-12-9-19/h5-6,13,15,19-20,27,33H,3-4,7-12,14,16H2,1-2H3,(H3,26,29,30,31)/t20-/m0/s1
InChI key:PVTVUOZOPYPPBJ-FQEVSTJZSA-N
SMILES:CCC[C@@H](CCO)NC1=NC(=NC2=C1N(N=C2)CC3=C(C=C(C=C3)CNC4CCOCC4)OC)N
Synonyms:- TLR7 agonist 17
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
TLR7 agonist 17
CAS:TLR7 agonist 17 (compound 20) functions as a highly effective TLR7 agonist, exhibiting EC 50 values of 12 nM for hTLR7 and 17 nM for mTLR7. Additionally, this compound has demonstrated anticancer activity [1].Formula:C25H37N7O3Color and Shape:SolidMolecular weight:483.61
