CymitQuimica logo

CAS 241125-75-7

:

Sibiricose A6

Description:
Sibiricose A6, with the CAS number 241125-75-7, is a chemical compound that belongs to a class of natural products known as polysaccharides. It is primarily derived from certain species of fungi or plants and is characterized by its complex carbohydrate structure, which may exhibit various biological activities. Sibiricose A6 is noted for its potential medicinal properties, including anti-inflammatory and immunomodulatory effects, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. Additionally, like many polysaccharides, it may have applications in food science, cosmetics, and biotechnology due to its thickening and gelling properties. Further studies are often required to fully elucidate its mechanisms of action and potential therapeutic uses. As with any chemical substance, safety data and handling precautions should be observed when working with Sibiricose A6.
Formula:C23H32O15
InChI:InChI=1S/C23H32O15/c1-33-11-5-10(6-12(34-2)16(11)28)3-4-15(27)36-21-18(30)14(8-25)37-23(21,9-26)38-22-20(32)19(31)17(29)13(7-24)35-22/h3-6,13-14,17-22,24-26,28-32H,7-9H2,1-2H3/b4-3+/t13-,14-,17-,18-,19+,20-,21+,22-,23+/m1/s1
InChI key:WTCVROXOIQEIRC-IBVGEFGBSA-N
SMILES:COC1=CC(=CC(=C1O)OC)/C=C/C(=O)O[C@H]2[C@@H]([C@H](O[C@@]2(CO)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)CO)O
Found 8 products.