CAS 241125-76-8

Formula: C24H26O14

InChI: InChI=1S/C24H26O14/c25-6-24(34)7-36-23(22(24)33)35-5-13-17(29)19(31)20(32)21(38-13)14-10(27)4-12-15(18(14)30)16(28)9-3-8(26)1-2-11(9)37-12/h1-4,13,17,19-23,25-27,29-34H,5-7H2/t13-,17-,19+,20-,21+,22+,23-,24-/m1/s1

InChI key: RQGJKXKUUWCQNK-ZBQXNOHASA-N

SMILES: C1[C@@]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)C3=C(C4=C(C=C3O)OC5=C(C4=O)C=C(C=C5)O)O)O)O)O)O)(CO)O

Sibiricaxanthone A

CAS: 241125-76-8

Formula: C₂₄H₂₆O₁₄

Molecular weight: 538.46

Ref: 7W-GY5406

Sibiricaxanthone A

CAS: 241125-76-8

Sibiricaxanthone A (Sibiricaxanthone A) is a natural product from Polygala tenuifolia

Formula: C₂₄H₂₆O₁₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 538.46

Ref: TM-TMA1948

Sibiricaxanthone A

CAS: 241125-76-8

Formula: C₂₄H₂₆O₁₄

Purity: 95%~99%

Molecular weight: 538.458

Ref: BP-BP3365

Sibiricaxanthone A

CAS: 241125-76-8

Sibiricaxanthone A is a natural compound, specifically a xanthone, which is isolated from the medicinal plant Sibirica. This compound is primarily sourced from the bark and roots of the plant species known for traditional medicinal applications. Sibiricaxanthone A exhibits its mode of action primarily through modulation of inflammatory pathways, including the inhibition of key enzymes and cytokines involved in inflammatory responses.

Formula: C₂₄H₂₆O₁₄

Purity: Min. 95%

Molecular weight: 538.5 g/mol

Ref: 3D-RJA12576