CymitQuimica logo

CAS 241125-81-5

:

Sibiricaxanthone B

Description:
Sibiricaxanthone B is a naturally occurring xanthone, a class of polyphenolic compounds known for their diverse biological activities. It is primarily derived from certain plant species, particularly those in the genus *Hypericum*. This compound is characterized by its yellow pigment, which is typical of xanthones, and it exhibits a range of pharmacological properties, including antioxidant, anti-inflammatory, and potential anticancer effects. Sibiricaxanthone B has garnered interest in medicinal chemistry due to its ability to modulate various biological pathways, making it a subject of research for therapeutic applications. Its chemical structure features a tricyclic core with hydroxyl groups that contribute to its reactivity and biological activity. Additionally, studies have indicated that it may interact with cellular signaling pathways, enhancing its potential as a lead compound in drug development. As with many natural products, the extraction and purification of Sibiricaxanthone B can be challenging, but its unique properties continue to drive research into its applications in health and medicine.
Formula:C24H26O14
InChI:InChI=1S/C24H26O14/c25-5-13-17(30)19(32)21(38-23-22(33)24(34,6-26)7-35-23)20(37-13)14-10(28)4-12-15(18(14)31)16(29)9-3-8(27)1-2-11(9)36-12/h1-4,13,17,19-23,25-28,30-34H,5-7H2/t13-,17-,19+,20+,21-,22+,23+,24-/m1/s1
InChI key:LLMCZIBSELEBMK-UKHOTDCGSA-N
SMILES:C1[C@@]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2C3=C(C4=C(C=C3O)OC5=C(C4=O)C=C(C=C5)O)O)CO)O)O)O)(CO)O
Found 6 products.