
CAS 2411637-68-6
:4- (1-hydroxy-1-methylethyl) -2-propyl -1H-imidazole-5- acetyl
Description:
4-(1-Hydroxy-1-methylethyl)-2-propyl-1H-imidazole-5-acetyl, identified by its CAS number 2411637-68-6, is a chemical compound that features a complex structure characteristic of imidazole derivatives. This substance typically exhibits properties associated with imidazole, such as potential biological activity, including antifungal and antibacterial effects. The presence of the hydroxy and acetyl functional groups suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. The propyl group contributes to its hydrophobic characteristics, which can affect its interaction with biological membranes. Additionally, the compound's imidazole ring may participate in various chemical reactions, making it a candidate for further research in medicinal chemistry. Its specific applications and efficacy would depend on detailed studies, including pharmacokinetics and toxicity assessments. Overall, this compound represents a unique structure that may have implications in pharmaceutical development and other chemical applications.
Formula:C11H18N2O2
InChI:InChI=1S/C11H18N2O2/c1-5-6-8-12-9(7(2)14)10(13-8)11(3,4)15/h15H,5-6H2,1-4H3,(H,12,13)
InChI key:SLYOSLKORVUNEK-UHFFFAOYSA-N
SMILES:CCCC1=NC(=C(N1)C(C)(C)O)C(=O)C
Synonyms:- 4- (1-hydroxy-1-methylethyl) -2-propyl -1H-imidazole-5- acetyl
- 1-(4-(2-hydroxypropan-2-yl)-2-propyl-1H-imidazol-5-yl)ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(4-(2-Hydroxypropan-2-yl)-2-propyl-1H-imidazol-5-yl)ethanone
CAS:Formula:C11H18N2O2Molecular weight:210.27
