CymitQuimica logo

CAS 2412-73-9

:

Cyclohexyl benzoate

Description:
Cyclohexyl benzoate is an organic compound classified as an ester, formed from the reaction of cyclohexanol and benzoic acid. It is characterized by its colorless to pale yellow liquid appearance and has a pleasant, aromatic odor. The compound is relatively non-polar, making it soluble in organic solvents while having limited solubility in water. Cyclohexyl benzoate is known for its use as a plasticizer and as a fragrance ingredient in various cosmetic and personal care products. Its chemical structure features a cyclohexyl group attached to a benzoate moiety, which contributes to its unique properties. The compound exhibits moderate volatility and stability under standard conditions, although it should be handled with care due to potential irritant effects. Additionally, it has a relatively low toxicity profile, making it suitable for various applications in the fragrance and polymer industries. As with all chemicals, proper safety measures should be observed when handling cyclohexyl benzoate to minimize exposure and environmental impact.
Formula:C13H16O2
InChI:InChI=1S/C13H16O2/c14-13(11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10H2
InChI key:InChIKey=DQZKGSRJOUYVPL-UHFFFAOYSA-N
SMILES:C(OC1CCCCC1)(=O)C2=CC=CC=C2
Synonyms:
  • Benzoic acid, cyclohexyl ester
  • Cyclohexyl benzoate
  • Cyclohexanol, benzoate
  • Hexahydrophenyl benzoate
  • Benzoic acid cyclohexanyl ester
Found 4 products.