CymitQuimica logo

CAS 2413-54-9

:

1-(4-Fluorophenyl)-2-methyl-2-propylamine hydrochloride

Description:
1-(4-Fluorophenyl)-2-methyl-2-propylamine hydrochloride, with the CAS number 2413-54-9, is a chemical compound that belongs to the class of substituted phenylamines. It features a fluorinated aromatic ring, which contributes to its unique chemical properties and potential biological activity. The presence of the amine functional group indicates that it can participate in hydrogen bonding, making it soluble in polar solvents. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its hydrochloride salt form enhances its stability and solubility in aqueous solutions, which is advantageous for various laboratory and therapeutic applications. The fluorine atom in the para position of the phenyl ring can influence the compound's lipophilicity and receptor binding affinity, making it a subject of interest in drug design. As with many amines, it may exhibit basic properties and can form salts with acids. Safety and handling precautions should be observed due to its potential biological effects and the need for proper disposal methods in laboratory settings.
Formula:C10H15ClFN
InChI:InChI=1/C10H14FN.ClH/c1-10(2,12)7-8-3-5-9(11)6-4-8;/h3-6H,7,12H2,1-2H3;1H
InChI key:WXNVDQWUGUEUMO-UHFFFAOYSA-N
SMILES:CC(C)(Cc1ccc(cc1)F)N.Cl
Synonyms:
  • 2-Amino-1-(4-fluorophenyl)-2-methylpropane hydrochloride~1,1-Dimethyl-2-(4-fluorophenyl)ethylamine hydrochloride~2-(4-Fluorophenyl)-tert-butylamine hydrochloride
  • 1-(4-Fluorophenyl)-2-Methylpropan-2-Amine Hydrochloride (1:1)
Found 2 products.