CymitQuimica logo

CAS 24133-87-7

:

2H-Benzimidazol-2-one,1,3-dihydro-1-methyl-7-nitro-

Description:
2H-Benzimidazol-2-one, 1,3-dihydro-1-methyl-7-nitro- (CAS 24133-87-7) is a chemical compound characterized by its benzimidazole core structure, which features a fused benzene and imidazole ring. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals and biochemistry due to its heterocyclic nature. The presence of a nitro group at the 7-position and a methyl group at the 1-position contributes to its chemical reactivity and biological activity. It may display various functional properties, including potential antimicrobial or anticancer activities, making it of interest in medicinal chemistry. The compound's solubility can vary depending on the solvent, and it may be sensitive to light or moisture. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions or reductions, which can be exploited in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H7N3O3
InChI:InChI=1S/C8H7N3O3/c1-10-7-5(9-8(10)12)3-2-4-6(7)11(13)14/h2-4H,1H3,(H,9,12)
InChI key:OXVKZFNTJAILFI-UHFFFAOYSA-N
SMILES:CN1C2=C(C=CC=C2[N+](=O)[O-])NC1=O
Synonyms:
  • 2-Benzimidazolinone,1-methyl-7-nitro- (8CI)
Found 5 products.