CAS 2416-20-8
:(11Z)-hexadec-11-enoic acid
Description:
(11Z)-Hexadec-11-enoic acid, also known as palmitoleic acid, is a monounsaturated fatty acid characterized by a long hydrocarbon chain with a double bond located at the 11th carbon from the carboxylic acid end, in the Z configuration. This structure contributes to its unique properties, including a relatively low melting point compared to saturated fatty acids of similar chain length, making it liquid at room temperature. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. This fatty acid is naturally occurring in various animal and plant fats, particularly in macadamia nuts and sea buckthorn oil. It plays a role in various biological processes, including cell membrane fluidity and signaling pathways. Additionally, (11Z)-hexadec-11-enoic acid is of interest in nutrition and health, as it may have beneficial effects on lipid metabolism and cardiovascular health. Its CAS number, 2416-20-8, is used for identification in chemical databases and regulatory contexts.
Formula:C16H30O2
InChI:InChI=1/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h5-6H,2-4,7-15H2,1H3,(H,17,18)/b6-5-
SMILES:CCCC/C=C\CCCCCCCCCC(=O)O
Synonyms:- 11-hexadecenoic acid, (11Z)-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(Z)-11-Hexadecenoic acid
CAS:(Z)-11-Hexadecenoic acid functions as a sex pheromone that attracts male Thaumetopoea pityocampa (pine processionary moths).Formula:C16H30O2Color and Shape:SolidMolecular weight:254.41(Z)-11- Hexadecenoic Acid
CAS:Controlled ProductApplications (Z)-11-Hexadecenoic Acid, is a monounsaturated fatty acid that is a minor constituent of ruminant fats.
References Alves, S.P., J. Dairy Sci. 89(1), 170-173 (2006);Formula:C16H30O2Color and Shape:NeatMolecular weight:254.41


