CymitQuimica logo

CAS 24167-51-9

:

3-bromo-N,N-dimethylbenzamide

Description:
3-Bromo-N,N-dimethylbenzamide is an organic compound characterized by its structure, which includes a benzamide moiety substituted with a bromine atom at the meta position relative to the amide group. This compound features a dimethylamino group, which contributes to its overall polarity and potential reactivity. The presence of the bromine atom introduces a halogen, which can influence the compound's chemical behavior, including its reactivity in nucleophilic substitution reactions and its ability to participate in various coupling reactions. The dimethylamino group enhances the electron density on the aromatic ring, potentially affecting electrophilic aromatic substitution reactions. 3-Bromo-N,N-dimethylbenzamide is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its applications can range from serving as an intermediate in organic synthesis to being utilized in pharmaceutical research due to its structural features that may confer biological activity. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts.
Formula:C9H10BrNO
InChI:InChI=1/C9H10BrNO/c1-11(2)9(12)7-4-3-5-8(10)6-7/h3-6H,1-2H3
InChI key:CGEIMYMVLYZNRJ-UHFFFAOYSA-N
SMILES:CN(C)C(=O)c1cccc(c1)Br
Found 5 products.